| Product Name | 3-Ethoxybenzhydrazide |
| CAS No. | 27830-16-6 |
| Synonyms | 3-ethoxybenzohydrazide |
| InChI | InChI=1/C9H12N2O2/c1-2-13-8-5-3-4-7(6-8)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12) |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.2038 |
| Density | 1.144g/cm3 |
| Refractive index | 1.549 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27830-16-6 3-ethoxybenzhydrazide
service@apichina.com