| Product Name | 3-Ethoxy-2-nitropyridine |
| CAS No. | 74037-50-6 |
| Synonyms | Pyridine, 3-ethoxy-2-nitro-; 4-21-00-00436 (Beilstein Handbook Reference); BRN 0141592 |
| InChI | InChI=1/C7H8N2O3/c1-2-12-6-4-3-5-8-7(6)9(10)11/h3-5H,2H2,1H3 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 |
| Density | 1.245g/cm3 |
| Melting point | 28-32℃ |
| Boiling point | 274.2°C at 760 mmHg |
| Flash point | 146.9°C |
| Refractive index | 1.537 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
74037-50-6 3-ethoxy-2-nitropyridine
service@apichina.com