| Product Name | 3-ethoxy-1,2-propanediol |
| CAS No. | 1874-62-0 |
| Synonyms | 1,2-Propanediol, 3-ethoxy-; 1-Ethoxy-2,3-propanediol; 3-Ethoxy-1,2-propanediol; BRN 1734312; Glycerol 1-ethyl ether; Glycerol alpha-ethyl ether; Glycerol alpha-monoethyl ether; NSC 227880; alpha-Ethyl glycerol ether; 3-Ethoxypropane-1,2-diol |
| InChI | InChI=1/C5H12O3/c1-2-8-4-5(7)3-6/h5-7H,2-4H2,1H3 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.147 |
| Density | 1.064g/cm3 |
| Boiling point | 241°C at 760 mmHg |
| Flash point | 99.5°C |
| Refractive index | 1.444 |
| Risk Codes | R36:Irritating to eyes.; |
| Safety | S24:Avoid contact with skin.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; |
1874-62-0 3-ethoxy-1,2-propanediol
service@apichina.com