| Product Name | 3-Dimethylaminobenzoyl chloride |
| CAS No. | 54263-82-0 |
| InChI | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.6348 |
| Density | 1.193g/cm3 |
| Boiling point | 275.9°C at 760 mmHg |
| Flash point | 120.7°C |
| Refractive index | 1.574 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
54263-82-0 3-dimethylaminobenzoyl chloride
service@apichina.com