| Product Name | 3-(Difluoromethylthio)benzoyl chloride |
| CAS No. | 261944-16-5 |
| Synonyms | 3-[(difluoromethyl)sulfanyl]benzoyl chloride |
| InChI | InChI=1/C8H5ClF2OS/c9-7(12)5-2-1-3-6(4-5)13-8(10)11/h1-4,8H |
| Molecular Formula | C8H5ClF2OS |
| Molecular Weight | 222.6395 |
| Density | 1.42g/cm3 |
| Boiling point | 238.5°C at 760 mmHg |
| Flash point | 98°C |
| Refractive index | 1.541 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261944-16-5 3-(difluoromethylthio)benzoyl chloride
service@apichina.com