| Product Name | 3-(Diethylamino)propionitrile |
| CAS No. | 5351-04-2 |
| Synonyms | 3-diethylaminopropiononitrile; N-(2-Cyanoethyl)diethylamine; 3-(Diethylamino)-Propanenitrile; N'-[(2-bromo-5-ethoxy-4-propoxyphenyl)methylidene]-4-nitrobenzohydrazide; 2-cyano-N,N-diethylethanaminium |
| InChI | InChI=1/C7H14N2/c1-3-9(4-2)7-5-6-8/h3-5,7H2,1-2H3/p+1 |
| Molecular Formula | C7H15N2 |
| Molecular Weight | 127.2069 |
| Melting point | -64℃ |
| Boiling point | 213.8°C at 760 mmHg |
| Flash point | 78.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5351-04-2 3-(diethylamino)propionitrile
service@apichina.com