| Product Name | 3-Diethylamino-1-propanol |
| CAS No. | 622-93-5 |
| InChI | InChI=1/C7H17NO/c1-3-8(4-2)6-5-7-9/h9H,3-7H2,1-2H3/p+1 |
| Molecular Formula | C7H18NO |
| Molecular Weight | 132.2234 |
| Boiling point | 189.5°C at 760 mmHg |
| Flash point | 65.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S7:Keep container tightly closed.; |
622-93-5 3-diethylamino-1-propanol
service@apichina.com