| Product Name | 3-Dibutylamino-1-propyne |
| CAS No. | 6336-58-9 |
| Synonyms | N-butyl-N-(prop-2-yn-1-yl)butan-1-amine |
| InChI | InChI=1/C11H21N/c1-4-7-10-12(9-6-3)11-8-5-2/h3H,4-5,7-11H2,1-2H3 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.2911 |
| Density | 0.831g/cm3 |
| Boiling point | 224.4°C at 760 mmHg |
| Flash point | 81.4°C |
| Refractive index | 1.454 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6336-58-9 3-dibutylamino-1-propyne
service@apichina.com