| Product Name | 3-(cyclopentyloxy)-4-methoxyaniline |
| CAS No. | 154464-26-3 |
| InChI | InChI=1/C12H17NO2/c1-14-11-7-6-9(13)8-12(11)15-10-4-2-3-5-10/h6-8,10H,2-5,13H2,1H3 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.2689 |
| Density | 1.123g/cm3 |
| Boiling point | 342.6°C at 760 mmHg |
| Flash point | 176.5°C |
| Refractive index | 1.567 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
154464-26-3 3-(cyclopentyloxy)-4-methoxyaniline
service@apichina.com