| Product Name | 3-cyanophenyl isothiocyanate |
| CAS No. | 3125-78-8 |
| Synonyms | 3-Isothiocyanatobenzonitrile |
| InChI | InChI=1/C8H4N2S/c9-5-7-2-1-3-8(4-7)10-6-11/h1-4H |
| Molecular Formula | C8H4N2S |
| Molecular Weight | 160.1958 |
| Density | 1.12g/cm3 |
| Melting point | 64-66℃ |
| Boiling point | 303.1°C at 760 mmHg |
| Flash point | 137.1°C |
| Refractive index | 1.604 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
3125-78-8 3-cyanophenyl isothiocyanate
service@apichina.com