| Product Name | 3-cyano-6,7-dimethylchromone |
| CAS No. | 94978-86-6 |
| Synonyms | 6,7-Dimethyl-4-oxo-4H-1-benzopyran-3-carbonitrile; 6,7-dimethyl-4-oxo-4H-chromene-3-carbonitrile |
| InChI | InChI=1/C12H9NO2/c1-7-3-10-11(4-8(7)2)15-6-9(5-13)12(10)14/h3-4,6H,1-2H3 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.2054 |
| Density | 1.25g/cm3 |
| Melting point | 206-209℃ |
| Boiling point | 347.8°C at 760 mmHg |
| Flash point | 151.8°C |
| Refractive index | 1.594 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
94978-86-6 3-cyano-6,7-dimethylchromone
service@apichina.com