| Product Name | (+/-)3-Cyano-3-hydroxy 1-azabicyclo[2,2,2]octane |
| CAS No. | 6238-30-8 |
| Synonyms | 3-Hydroxyquinuclidine-3-carbonitrile; 3-Quinuclidinol cyanohydrine; 3-hydroxy-1-azabicyclo[2.2.2]octane-3-carbonitrile; 3-{[3-(furan-2-ylmethyl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-2-[(2-hydroxyethyl)amino]-4H-pyrido[1,2-a]pyrimidin-4-one |
| InChI | InChI=1/C19H16N4O4S2/c24-8-6-20-16-13(17(25)22-7-2-1-5-15(22)21-16)10-14-18(26)23(19(28)29-14)11-12-4-3-9-27-12/h1-5,7,9-10,20,24H,6,8,11H2 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.4847 |
| Density | 1.54g/cm3 |
| Melting point | 161℃ |
| Boiling point | 534.7°C at 760 mmHg |
| Flash point | 277.2°C |
| Refractive index | 1.752 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6238-30-8 (+/-)3-cyano-3-hydroxy 1-azabicyclo[2,2,2]octane
service@apichina.com