| Product Name | 3-Chloropropyl thioacetate |
| CAS No. | 13012-54-9 |
| InChI | InChI=1/C5H9ClOS/c1-5(7)8-4-2-3-6/h2-4H2,1H3 |
| Molecular Formula | C5H9ClOS |
| Molecular Weight | 152.6424 |
| Density | 1.143g/cm3 |
| Boiling point | 200.4°C at 760 mmHg |
| Flash point | 77.8°C |
| Refractive index | 1.482 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
13012-54-9 3-chloropropyl thioacetate
service@apichina.com