| Product Name | 3-Chlorophenylthiourea |
| CAS No. | 4947-89-1 |
| Synonyms | Thiourea, (3-chlorophenyl)- (9CI); (m-Chlorophenyl)thiourea; 1-(m-Chlorophenyl)thiourea; 3-(Chlorophenyl)thiourea; 3-Chlorophenyl thiourea; 4-12-00-01155 (Beilstein Handbook Reference); BRN 2090370; N-(3-Chlorophenyl)thiourea; NSC 164965; Urea, 1-(m-chlorophenyl)-2-thio-; 1-(3-chlorophenyl)thiourea |
| InChI | InChI=1/C7H7ClN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Molecular Formula | C7H7ClN2S |
| Molecular Weight | 186.6619 |
| Density | 1.441g/cm3 |
| Boiling point | 296.7°C at 760 mmHg |
| Flash point | 133.2°C |
| Refractive index | 1.727 |
| Risk Codes | R28:Very toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4947-89-1 3-chlorophenylthiourea
service@apichina.com