| Product Name | 3-Chlorophenoxyacetonitrile |
| CAS No. | 43111-32-6 |
| InChI | InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.5923 |
| Density | 1.238g/cm3 |
| Melting point | 30℃ |
| Boiling point | 279.8°C at 760 mmHg |
| Flash point | 123°C |
| Refractive index | 1.538 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
43111-32-6 3-chlorophenoxyacetonitrile
service@apichina.com