| Product Name | 3-(chloromethyl)-1,2,4,5-tetramethylbenzene |
| CAS No. | 7435-83-8 |
| Synonyms | 2,3,5,6-Tetramethylbenzyl chloride |
| InChI | InChI=1/C11H15Cl/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 |
| Melting point | 167-69℃ |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
7435-83-8 3-(chloromethyl)-1,2,4,5-tetramethylbenzene
service@apichina.com