| Product Name | 3-Chlorodiphenylamine |
| CAS No. | 101-17-7 |
| Synonyms | Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| InChI | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| Molecular Formula | C12H10ClN |
| Molecular Weight | 203.6675 |
| Density | 1.216g/cm3 |
| Boiling point | 337.8°C at 760 mmHg |
| Flash point | 147.4°C |
| Refractive index | 1.642 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
101-17-7 3-chlorodiphenylamine
service@apichina.com