| Product Name | 3-chlorobiphenyl |
| CAS No. | 2051-61-8 |
| Synonyms | 3-Chloro-1,1-biphenyl; 3-PCB |
| InChI | InChI=1/C12H9Cl/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| Molecular Formula | C12H9Cl |
| Molecular Weight | 188.6529 |
| Density | 1.131g/cm3 |
| Boiling point | 284.5°C at 760 mmHg |
| Flash point | 129.5°C |
| Refractive index | 1.583 |
| Risk Codes | R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S60:This material and its container must be disposed of as hazardous waste.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
2051-61-8 3-chlorobiphenyl
service@apichina.com