| Product Name | 3-Chlorobenzoylacetonitrile, |
| CAS No. | 21667-62-9 |
| Synonyms | 3-Chlorobenzoylacetonitrile; 3-(3-Chlorophenyl)-3-oxopropanenitrile |
| InChI | InChI=1/C9H6ClNO/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6H,4H2 |
| Molecular Formula | C9H6ClNO |
| Molecular Weight | 179.603 |
| Density | 1.257g/cm3 |
| Melting point | 78℃ |
| Boiling point | 347.1°C at 760 mmHg |
| Flash point | 163.7°C |
| Refractive index | 1.553 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21667-62-9 3-chlorobenzoylacetonitrile,
service@apichina.com