| Product Name | 3-Chlorobenzo[b]thiophene-2-carboxamide |
| CAS No. | 21211-09-6 |
| Synonyms | 3-chloro-1-benzothiophene-2-carboxamide; 3-Chlorobenzothiophene-2-carboxaMide |
| InChI | InChI=1/C9H6ClNOS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H2,11,12) |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.668 |
| Density | 1.473g/cm3 |
| Melting point | 235℃ |
| Boiling point | 392.7°C at 760 mmHg |
| Flash point | 191.3°C |
| Refractive index | 1.712 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21211-09-6 3-chlorobenzo[b]thiophene-2-carboxamide
service@apichina.com