| Product Name | 3-chlorobenzo[b]thiophene-2-carbohydrazide |
| CAS No. | 62524-21-4 |
| Synonyms | 3-chloro-1-benzothiophene-2-carbohydrazide; 3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
| InChI | InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.6827 |
| Density | 1.486g/cm3 |
| Melting point | 181℃ |
| Refractive index | 1.714 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide
service@apichina.com