| Product Name | 3-Chlorobenzo[b]-2-thiophenecarboxylic acid |
| CAS No. | 21211-22-3 |
| Synonyms | 3-Chlorobenzo[b]thiophene-2-carboxylic acid; 3-CHLORO-BENZO[B]THIOPHENE CARBOXYLIC ACID; 3-CHLORO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID; 3-CHLORO-2-BENZO[B]THIOPHENE CARBOXYLIC ACID; AKOS BBB/202; AKOS B000001; AKOS AU36-M200; BUTTPARK 30\06-07; 3-Chlorobenzothiophene-2-carboxylic acid |
| InChI | InChI=1/C9H5ClO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H,11,12) |
| Molecular Formula | C9H5ClO2S |
| Molecular Weight | 212.6528 |
| Density | 1.546g/cm3 |
| Boiling point | 395.1°C at 760 mmHg |
| Flash point | 192.8°C |
| Refractive index | 1.719 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21211-22-3 3-chlorobenzo[b]-2-thiophenecarboxylic acid
service@apichina.com