| Product Name | 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride |
| CAS No. | 21815-91-8 |
| Synonyms | 3-Chlorobenzo[b]thiophene-2-carbonyl chloride; AKOS B000002; AKOS AU36-M326; AKOS 92491; 3-CHLOROBENZOTHIOPHENE-2-CARBONYL CHLORIDE; BUTTPARK 30\06-08; ASISCHEM T31091; ART-CHEM-BB B000002; 3-chloro-1-benzothiophene-2-carbonyl chloride |
| InChI | InChI=1/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H |
| Molecular Formula | C9H4Cl2OS |
| Molecular Weight | 231.0985 |
| Density | 1.526g/cm3 |
| Melting point | 114℃ |
| Boiling point | 342.2°C at 760 mmHg |
| Flash point | 160.7°C |
| Refractive index | 1.686 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
21815-91-8 3-chlorobenzo[b]-2-thiophenecarboxylic acid chloride
service@apichina.com