| Product Name | 3-Chlorobenzhydrazide |
| CAS No. | 1673-47-8 |
| Synonyms | 3-Chlorobenzhydrazide, (3-Chlorobenzoic acid hydrazide); SPECS AN-068/40169986; ASISCHEM D51116; 3-CHLOROBENZOIC HYDRAZIDE; 3-CHLOROBENZOIC ACID HYDRAZIDE; 3-CHLOROBENZENE-1-CARBOHYDRAZIDE; AKOS BBS-00004508; Benzoic acid, 3-chloro-, hydrazide; 3-chlorobenzohydrazide |
| InChI | InChI=1/C7H7ClN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.5963 |
| Density | 1.323g/cm3 |
| Boiling point | 350.4°C at 760 mmHg |
| Flash point | 165.7°C |
| Refractive index | 1.592 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1673-47-8 3-chlorobenzhydrazide
service@apichina.com