| Product Name | 3-Chloro-N,N-dimethylaniline |
| CAS No. | 6848-13-1 |
| Synonyms | 3-Chloro-NN-dimethylaniline |
| InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.6247 |
| Density | 1.117g/cm3 |
| Boiling point | 232.663°C at 760 mmHg |
| Flash point | 94.512°C |
| Refractive index | 1.566 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
6848-13-1 3-chloro-n,n-dimethylaniline
service@apichina.com