| Product Name | 3-Chloro-N-(chloroacetyl)-4-fluoroaniline |
| CAS No. | 96980-64-2 |
| Synonyms | N1-(3-Chloro-4-fluorophenyl)-2-chloroacetamide; 2-chloro-N-(3-chloro-4-fluorophenyl)acetamide |
| InChI | InChI=1/C8H6Cl2FNO/c9-4-8(13)12-5-1-2-7(11)6(10)3-5/h1-3H,4H2,(H,12,13) |
| Molecular Formula | C8H6Cl2FNO |
| Molecular Weight | 222.0437 |
| Density | 1.479g/cm3 |
| Melting point | 98-101℃ |
| Boiling point | 363.2°C at 760 mmHg |
| Flash point | 173.5°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
96980-64-2 3-chloro-n-(chloroacetyl)-4-fluoroaniline
service@apichina.com