| Product Name | 3-Chloro-6-methoxypyridazine |
| CAS No. | 1722-10-7 |
| InChI | InChI=1/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
| Molecular Formula | C5H5ClN2O |
| Molecular Weight | 144.559 |
| Density | 1.292g/cm3 |
| Melting point | 85-92℃ |
| Boiling point | 284.9°C at 760 mmHg |
| Flash point | 126.1°C |
| Refractive index | 1.52 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1722-10-7 3-chloro-6-methoxypyridazine
service@apichina.com