| Product Name | 3-chloro-6-[(5-chloro-3-pyridyl)oxy]pyridazine |
| CAS No. | 175135-61-2 |
| Synonyms | 3-chloro-6-[(5-chloropyridin-3-yl)oxy]pyridazine |
| InChI | InChI=1/C9H5Cl2N3O/c10-6-3-7(5-12-4-6)15-9-2-1-8(11)13-14-9/h1-5H |
| Molecular Formula | C9H5Cl2N3O |
| Molecular Weight | 242.0615 |
| Density | 1.479g/cm3 |
| Melting point | 107℃ |
| Boiling point | 410.5°C at 760 mmHg |
| Flash point | 202.1°C |
| Refractive index | 1.61 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-61-2 3-chloro-6-[(5-chloro-3-pyridyl)oxy]pyridazine
service@apichina.com