| Product Name | 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
| CAS No. | 17530-69-7 |
| Synonyms | 3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
| InChI | InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.6253 |
| Density | 1.09g/cm3 |
| Boiling point | 217.7°C at 760 mmHg |
| Flash point | 104.8°C |
| Refractive index | 1.488 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17530-69-7 3-chloro-5,5-dimethyl-2-cyclohexen-1-one
service@apichina.com