| Product Name | 3-chloro-5-(2-chlorophenyl)isothiazole-4-carboxylic acid |
| CAS No. | 306935-52-4 |
| InChI | InChI=1/C10H5Cl2NO2S/c11-6-4-2-1-3-5(6)8-7(10(14)15)9(12)13-16-8/h1-4H,(H,14,15) |
| Molecular Formula | C10H5Cl2NO2S |
| Molecular Weight | 274.1232 |
| Density | 1.576g/cm3 |
| Melting point | 144℃ |
| Boiling point | 298.2°C at 760 mmHg |
| Flash point | 134.1°C |
| Refractive index | 1.658 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-52-4 3-chloro-5-(2-chlorophenyl)isothiazole-4-carboxylic acid
service@apichina.com