| Product Name | 3-chloro-4-methylthiophene-2-carboxylic acid |
| CAS No. | 229342-86-3 |
| InChI | InChI=1/C6H5ClO2S/c1-3-2-10-5(4(3)7)6(8)9/h2H,1H3,(H,8,9) |
| Molecular Formula | C6H5ClO2S |
| Molecular Weight | 176.6207 |
| Density | 1.475g/cm3 |
| Melting point | 221℃ |
| Boiling point | 298.7°C at 760 mmHg |
| Flash point | 134.4°C |
| Refractive index | 1.606 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
229342-86-3 3-chloro-4-methylthiophene-2-carboxylic acid
service@apichina.com