| Product Name | 3-chloro-4-methylthiophene-2-carbohydrazide |
| CAS No. | 175137-12-9 |
| InChI | InChI=1/C6H7ClN2OS/c1-3-2-11-5(4(3)7)6(10)9-8/h2H,8H2,1H3,(H,9,10) |
| Molecular Formula | C6H7ClN2OS |
| Molecular Weight | 190.6506 |
| Density | 1.415g/cm3 |
| Melting point | 130℃ |
| Refractive index | 1.613 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
service@apichina.com