| Product Name | 3-chloro-4-methyl-7-hydroxycoumarin |
| CAS No. | 6174-86-3 |
| Synonyms | 3-Chloro-4-methylumbelliferone; 3-Chloro-7-hydroxy-4-methylcoumarin; 3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
| InChI | InChI=1/C10H7ClO3/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-4,12H,1H3 |
| Molecular Formula | C10H7ClO3 |
| Molecular Weight | 210.6138 |
| Density | 1.48g/cm3 |
| Boiling point | 405.8°C at 760 mmHg |
| Flash point | 199.2°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
service@apichina.com