| Product Name | 3-chloro-4-fluorophenylhydrazine |
| CAS No. | 84282-78-0 |
| InChI | InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
| Molecular Formula | C6H6ClFN2 |
| Molecular Weight | 160.5766 |
| Density | 1.43g/cm3 |
| Melting point | 62-63℃ |
| Boiling point | 253.1°C at 760 mmHg |
| Flash point | 106.9°C |
| Refractive index | 1.624 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
84282-78-0 3-chloro-4-fluorophenylhydrazine
service@apichina.com