| Product Name | 3-chloro-4-(fluorophenyl)isocyanate |
| CAS No. | 50529-33-4 |
| Synonyms | 3-Chloro-4-fluorophenyl isocyanate; 2-chloro-1-fluoro-4-isocyanatobenzene |
| InChI | InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| Molecular Formula | C7H3ClFNO |
| Molecular Weight | 171.5562 |
| Density | 1.31g/cm3 |
| Boiling point | 228.7°C at 760 mmHg |
| Flash point | 92.1°C |
| Refractive index | 1.533 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate
service@apichina.com