| Product Name | 3-Chloro-4-fluorobenzyl alcohol |
| CAS No. | 161446-90-8 |
| Synonyms | (3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
| InChI | InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| Molecular Formula | C7H6ClFO |
| Molecular Weight | 160.5733 |
| Density | 1.344g/cm3 |
| Boiling point | 242.5°C at 760 mmHg |
| Flash point | 100.4°C |
| Refractive index | 1.542 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
161446-90-8 3-chloro-4-fluorobenzyl alcohol
service@apichina.com