| Product Name | 3-Chloro-4-fluoroanisole |
| CAS No. | 202925-07-3 |
| Synonyms | 2-chloro-1-fluoro-4-methoxybenzene |
| InChI | InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| Molecular Formula | C7H6ClFO |
| Molecular Weight | 160.5733 |
| Density | 1.239g/cm3 |
| Boiling point | 202.8°C at 760 mmHg |
| Flash point | 76.4°C |
| Refractive index | 1.495 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
202925-07-3 3-chloro-4-fluoroanisole
service@apichina.com