| Product Name | 3-Chloro-2-methylpropionitrile |
| CAS No. | 7659-45-2 |
| InChI | InChI=1/C4H6ClN/c1-4(2-5)3-6/h4H,2H2,1H3/t4-/m1/s1 |
| Molecular Formula | C4H6ClN |
| Molecular Weight | 103.5501 |
| Density | 1.038g/cm3 |
| Boiling point | 164.7°C at 760 mmHg |
| Flash point | 61.1°C |
| Refractive index | 1.421 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
7659-45-2 3-chloro-2-methylpropionitrile
service@apichina.com