| Product Name | 3-Chloro-2,6-difluorophenylacetonitrile |
| CAS No. | 261762-55-4 |
| Synonyms | 3-Chloro-2,6-difluorobenzyl cyanide |
| InChI | InChI=1/C8H4ClF2N/c9-6-1-2-7(10)5(3-4-12)8(6)11/h1-2H,3H2 |
| Molecular Formula | C8H4ClF2N |
| Molecular Weight | 187.5739 |
| Density | 1.379g/cm3 |
| Boiling point | 248.4°C at 760 mmHg |
| Flash point | 104°C |
| Refractive index | 1.508 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
261762-55-4 3-chloro-2,6-difluorophenylacetonitrile
service@apichina.com