| Product Name | 3-Chloro-2,6-difluorobenzyl bromide |
| CAS No. | 261762-47-4 |
| Synonyms | alpha-Bromo-3-chloro-2,6-difluorotoluene; 2-(bromomethyl)-4-chloro-1,3-difluorobenzene |
| InChI | InChI=1/C7H4BrClF2/c8-3-4-6(10)2-1-5(9)7(4)11/h1-2H,3H2 |
| Molecular Formula | C7H4BrClF2 |
| Molecular Weight | 241.4605 |
| Density | 1.733g/cm3 |
| Boiling point | 222.9°C at 760 mmHg |
| Flash point | 88.6°C |
| Refractive index | 1.541 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261762-47-4 3-chloro-2,6-difluorobenzyl bromide
service@apichina.com