| Product Name | 3-Chloro-2,6-difluorobenzoic acid |
| CAS No. | 225104-76-7 |
| InChI | InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
| Molecular Formula | C7H3ClF2O2 |
| Molecular Weight | 192.5473 |
| Density | 1.573g/cm3 |
| Boiling point | 264.5°C at 760 mmHg |
| Flash point | 113.8°C |
| Refractive index | 1.534 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
225104-76-7 3-chloro-2,6-difluorobenzoic acid
service@apichina.com