| Sales Email | Service@apichina.com |
| CAS No. | 154257-75-7 |
| Product Name | 3-Chloro-2,4-difluorobenzoic acid |
| Synonyms | 1-fluoro-4-isothiocyanatobenzene; 3-chloro-2,4-difluorobenzoate; 3-Chloro-2,4-Difluoro-Benzoic Acid |
| InChI | InChI=1/C7H3ClF2O2/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2H,(H,11,12)/p-1 |
| Molecular Formula | C7H2ClF2O2 |
| Molecular Weight | 191.5399 |
| Boiling point | 276.7°C at 760 mmHg |
| Flash point | 121.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
