| Product Name | 3-Carboxyphenyl isothiocyanate |
| CAS No. | 2131-63-7 |
| Synonyms | 3-Isothiocyanatobenzoic acid |
| InChI | InChI=1/C8H5NO2S/c10-8(11)6-2-1-3-7(4-6)9-5-12/h1-4H,(H,10,11) |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.1958 |
| Density | 1.27g/cm3 |
| Boiling point | 381.2°C at 760 mmHg |
| Flash point | 184.4°C |
| Refractive index | 1.612 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2131-63-7 3-carboxyphenyl isothiocyanate
service@apichina.com