| Product Name | 3-butoxycyclohex-2-en-1-one |
| CAS No. | 16493-04-2 |
| Synonyms | 3-Butoxycyclohex-2-en-1-one; AI3-08102; 2-Cyclohexen-1-one, 3-butoxy- |
| InChI | InChI=1/C10H16O2/c1-2-3-7-12-10-6-4-5-9(11)8-10/h8H,2-7H2,1H3 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.2328 |
| Density | 0.97g/cm3 |
| Boiling point | 280.6°C at 760 mmHg |
| Flash point | 121.1°C |
| Refractive index | 1.468 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
16493-04-2 3-butoxycyclohex-2-en-1-one
service@apichina.com