| Product Name | 3-Bromothiophene-2-carboxaldehyde diethyl acetal |
| CAS No. | 34042-95-0 |
| Synonyms | 3-bromo-2-(diethoxymethyl)thiophene |
| InChI | InChI=1/C9H13BrO2S/c1-3-11-9(12-4-2)8-7(10)5-6-13-8/h5-6,9H,3-4H2,1-2H3 |
| Molecular Formula | C9H13BrO2S |
| Molecular Weight | 265.1673 |
| Density | 1.388g/cm3 |
| Boiling point | 272.1°C at 760 mmHg |
| Flash point | 118.4°C |
| Refractive index | 1.533 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
34042-95-0 3-bromothiophene-2-carboxaldehyde diethyl acetal
service@apichina.com