| Product Name | 3-Bromothiophene-2-carbonitrile |
| CAS No. | 18791-98-5 |
| Synonyms | 3-Bromo-2-cyanothiophene |
| InChI | InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
| Molecular Formula | C5H2BrNS |
| Molecular Weight | 188.0451 |
| Density | 1.82g/cm3 |
| Boiling point | 286.8°C at 760 mmHg |
| Flash point | 127.3°C |
| Refractive index | 1.641 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
18791-98-5 3-bromothiophene-2-carbonitrile
service@apichina.com