| Product Name | 3-Bromothioanisole |
| CAS No. | 33733-73-2 |
| Synonyms | 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| InChI | InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| Molecular Formula | C7H7BrOS |
| Molecular Weight | 219.0989 |
| Density | 1.567g/cm3 |
| Boiling point | 278.106°C at 760 mmHg |
| Flash point | 121.995°C |
| Refractive index | 1.616 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S23:; S24/25:; |
33733-73-2 3-bromothioanisole
service@apichina.com