| Product Name | 3-bromopropionaldehyde dimethyl acetal |
| CAS No. | 36255-44-4 |
| Synonyms | 1-Bromo-3,3-dimethoxypropane; 3-bromo-1,1-dimethoxypropane |
| InChI | InChI=1/C5H11BrO2/c1-7-5(8-2)3-4-6/h5H,3-4H2,1-2H3 |
| Molecular Formula | C5H11BrO2 |
| Molecular Weight | 183.0436 |
| Density | 1.332g/cm3 |
| Boiling point | 164.8°C at 760 mmHg |
| Flash point | 14°C |
| Refractive index | 1.442 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
36255-44-4 3-bromopropionaldehyde dimethyl acetal
service@apichina.com