| Product Name | 3-Bromo-N,N-dimethylaniline |
| CAS No. | 16518-62-0 |
| Synonyms | Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
| InChI | InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.0757 |
| Density | 1.393g/cm3 |
| Boiling point | 259.7°C at 760 mmHg |
| Flash point | 110.8°C |
| Refractive index | 1.586 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
16518-62-0 3-bromo-n,n-dimethylaniline
service@apichina.com