| Product Name | 3-Bromo-4-hydroxybenzonitrile |
| CAS No. | 2315-86-8 |
| Synonyms | 2-Bromo-4-cyanophenol |
| InChI | InChI=1/C7H4BrNO/c8-6-3-5(4-9)1-2-7(6)10/h1-3,10H |
| Molecular Formula | C7H4BrNO |
| Molecular Weight | 198.0168 |
| Density | 1.79g/cm3 |
| Melting point | 155℃ |
| Boiling point | 271.1°C at 760 mmHg |
| Flash point | 117.8°C |
| Refractive index | 1.656 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
2315-86-8 3-bromo-4-hydroxybenzonitrile
service@apichina.com